C24H27ClN6O3S — CID 51857135
2-[[5-[(4-chloroanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]acetamide (PubChem CID 51857135) has the molecular formula C24H27ClN6O3S and a molecular weight of 515.04 g/mol. Its IUPAC name is 2-[[5-[(4-chloroanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]acetamide.
| Compound Name | 2-[[5-[(4-chloroanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 51857135 |
| Molecular Formula | C24H27ClN6O3S |
| Molecular Weight | 515.04 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | 2-[[5-[(4-chloroanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]acetamide |
| SMILES | C=CCn1c(CNc2ccc(Cl)cc2)nnc1SCC(=O)N/N=C(/C)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C24H27ClN6O3S/c1-5-12-31-22(14-26-18-8-6-17(25)7-9-18)28-30-24(31)35-15-23(32)29-27-16(2)20-11-10-19(33-3)13-21(20)34-4/h5-11,13,26H,1,12,14-15H2,2-4H3,(H,29,32)/b27-16- |
| InChIKey | WBLWWFWTYBTRMT-YUMHPJSZSA-N |
| XLogP | 4.38 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.04 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|