C20H20ClN7OS — CID 5209153
2-[[5-[(4-chloroanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(pyridin-3-ylmethylideneamino)acetamide (PubChem CID 5209153) has the molecular formula C20H20ClN7OS and a molecular weight of 441.95 g/mol. Its IUPAC name is 2-[[5-[(4-chloroanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(pyridin-3-ylmethylideneamino)acetamide.
| Compound Name | 2-[[5-[(4-chloroanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(pyridin-3-ylmethylideneamino)acetamide |
|---|---|
| PubChem CID | 5209153 |
| Molecular Formula | C20H20ClN7OS |
| Molecular Weight | 441.95 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 2-[[5-[(4-chloroanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(pyridin-3-ylmethylideneamino)acetamide |
| SMILES | C=CCn1c(CNc2ccc(Cl)cc2)nnc1SCC(=O)NN=Cc1cccnc1 |
| InChI | InChI=1S/C20H20ClN7OS/c1-2-10-28-18(13-23-17-7-5-16(21)6-8-17)25-27-20(28)30-14-19(29)26-24-12-15-4-3-9-22-11-15/h2-9,11-12,23H,1,10,13-14H2,(H,26,29) |
| InChIKey | CCEMXEPZHROQSI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 97.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.95 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|