C23H19ClN6OS — CID 6866501
2-[[4-(4-chlorophenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-pyridin-3-ylmethylideneamino]acetamide (PubChem CID 6866501) has the molecular formula C23H19ClN6OS and a molecular weight of 462.97 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-pyridin-3-ylmethylideneamino]acetamide.
| Compound Name | 2-[[4-(4-chlorophenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-pyridin-3-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 6866501 |
| Molecular Formula | C23H19ClN6OS |
| Molecular Weight | 462.97 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-pyridin-3-ylmethylideneamino]acetamide |
| SMILES | Cc1ccc(-c2nnc(SCC(=O)N/N=C/c3cccnc3)n2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H19ClN6OS/c1-16-4-6-18(7-5-16)22-28-29-23(30(22)20-10-8-19(24)9-11-20)32-15-21(31)27-26-14-17-3-2-12-25-13-17/h2-14H,15H2,1H3,(H,27,31)/b26-14+ |
| InChIKey | PGJSPKOEDQVXAL-VULFUBBASA-N |
| XLogP | 4.53 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.97 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|