C23H20N6OS — CID 1051340
2-[[4-(4-methylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(pyridin-4-ylmethylideneamino)acetamide (PubChem CID 1051340) has the molecular formula C23H20N6OS and a molecular weight of 428.52 g/mol. Its IUPAC name is 2-[[4-(4-methylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(pyridin-4-ylmethylideneamino)acetamide.
| Compound Name | 2-[[4-(4-methylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(pyridin-4-ylmethylideneamino)acetamide |
|---|---|
| PubChem CID | 1051340 |
| Molecular Formula | C23H20N6OS |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 2-[[4-(4-methylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(pyridin-4-ylmethylideneamino)acetamide |
| SMILES | Cc1ccc(-n2c(SCC(=O)NN=Cc3ccncc3)nnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20N6OS/c1-17-7-9-20(10-8-17)29-22(19-5-3-2-4-6-19)27-28-23(29)31-16-21(30)26-25-15-18-11-13-24-14-12-18/h2-15H,16H2,1H3,(H,26,30) |
| InChIKey | BJSCBWINWPMFTJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|