C27H29N7OS — CID 3250025
N-[[4-(diethylamino)phenyl]methylideneamino]-2-[[4-(4-methylphenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 3250025) has the molecular formula C27H29N7OS and a molecular weight of 499.64 g/mol. Its IUPAC name is N-[[4-(diethylamino)phenyl]methylideneamino]-2-[[4-(4-methylphenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[[4-(diethylamino)phenyl]methylideneamino]-2-[[4-(4-methylphenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3250025 |
| Molecular Formula | C27H29N7OS |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | N-[[4-(diethylamino)phenyl]methylideneamino]-2-[[4-(4-methylphenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCN(CC)c1ccc(C=NNC(=O)CSc2nnc(-c3ccncc3)n2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H29N7OS/c1-4-33(5-2)23-12-8-21(9-13-23)18-29-30-25(35)19-36-27-32-31-26(22-14-16-28-17-15-22)34(27)24-10-6-20(3)7-11-24/h6-18H,4-5,19H2,1-3H3,(H,30,35) |
| InChIKey | GGAVIVUYOBZTTO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 88.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|