C27H27BrN6OS — CID 4510288
2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[[4-(diethylamino)phenyl]methylideneamino]acetamide (PubChem CID 4510288) has the molecular formula C27H27BrN6OS and a molecular weight of 563.53 g/mol. Its IUPAC name is 2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[[4-(diethylamino)phenyl]methylideneamino]acetamide.
| Compound Name | 2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[[4-(diethylamino)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 4510288 |
| Molecular Formula | C27H27BrN6OS |
| Molecular Weight | 563.53 g/mol |
| Exact Mass | 562.12 |
| IUPAC Name | 2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[[4-(diethylamino)phenyl]methylideneamino]acetamide |
| SMILES | CCN(CC)c1ccc(C=NNC(=O)CSc2nnc(-c3ccccc3)n2-c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C27H27BrN6OS/c1-3-33(4-2)23-14-10-20(11-15-23)18-29-30-25(35)19-36-27-32-31-26(21-8-6-5-7-9-21)34(27)24-16-12-22(28)13-17-24/h5-18H,3-4,19H2,1-2H3,(H,30,35) |
| InChIKey | OFYGAWMENSAQJW-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 75.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.53 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|