C27H27ClN6O4S — CID 17047972
2-[[5-[(4-chloroanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[5-[(4-methoxyphenyl)methoxy]furan-2-yl]methylideneamino]acetamide (PubChem CID 17047972) has the molecular formula C27H27ClN6O4S and a molecular weight of 567.07 g/mol. Its IUPAC name is 2-[[5-[(4-chloroanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[5-[(4-methoxyphenyl)methoxy]furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-[[5-[(4-chloroanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[5-[(4-methoxyphenyl)methoxy]furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 17047972 |
| Molecular Formula | C27H27ClN6O4S |
| Molecular Weight | 567.07 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | 2-[[5-[(4-chloroanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[5-[(4-methoxyphenyl)methoxy]furan-2-yl]methylideneamino]acetamide |
| SMILES | C=CCn1c(CNc2ccc(Cl)cc2)nnc1SCC(=O)N/N=C/c1ccc(OCc2ccc(OC)cc2)o1 |
| InChI | InChI=1S/C27H27ClN6O4S/c1-3-14-34-24(16-29-21-8-6-20(28)7-9-21)31-33-27(34)39-18-25(35)32-30-15-23-12-13-26(38-23)37-17-19-4-10-22(36-2)11-5-19/h3-13,15,29H,1,14,16-18H2,2H3,(H,32,35)/b30-15+ |
| InChIKey | MKWUPPREOHIJHY-FJEPWZHXSA-N |
| XLogP | 5.15 |
| TPSA | 115.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.07 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|