C27H27FN6O3S — CID 17048018
2-[[5-(anilinomethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[5-[(4-fluorophenyl)methoxy]furan-2-yl]methylideneamino]propanamide (PubChem CID 17048018) has the molecular formula C27H27FN6O3S and a molecular weight of 534.62 g/mol. Its IUPAC name is 2-[[5-(anilinomethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[5-[(4-fluorophenyl)methoxy]furan-2-yl]methylideneamino]propanamide.
| Compound Name | 2-[[5-(anilinomethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[5-[(4-fluorophenyl)methoxy]furan-2-yl]methylideneamino]propanamide |
|---|---|
| PubChem CID | 17048018 |
| Molecular Formula | C27H27FN6O3S |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | 2-[[5-(anilinomethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[5-[(4-fluorophenyl)methoxy]furan-2-yl]methylideneamino]propanamide |
| SMILES | C=CCn1c(CNc2ccccc2)nnc1SC(C)C(=O)N/N=C/c1ccc(OCc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C27H27FN6O3S/c1-3-15-34-24(17-29-22-7-5-4-6-8-22)31-33-27(34)38-19(2)26(35)32-30-16-23-13-14-25(37-23)36-18-20-9-11-21(28)12-10-20/h3-14,16,19,29H,1,15,17-18H2,2H3,(H,32,35)/b30-16+ |
| InChIKey | QMYMLYFDFLBBPZ-OKCVXOCRSA-N |
| XLogP | 5.02 |
| TPSA | 106.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|