C22H21Cl2N7O4S — CID 137195427
(2R)-2-[[5-[(4-chloroanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]propanamide (PubChem CID 137195427) has the molecular formula C22H21Cl2N7O4S and a molecular weight of 550.43 g/mol. Its IUPAC name is (2R)-2-[[5-[(4-chloroanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]propanamide.
| Compound Name | (2R)-2-[[5-[(4-chloroanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 137195427 |
| Molecular Formula | C22H21Cl2N7O4S |
| Molecular Weight | 550.43 g/mol |
| Exact Mass | 549.08 |
| IUPAC Name | (2R)-2-[[5-[(4-chloroanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]propanamide |
| SMILES | C=CCn1c(CNc2ccc(Cl)cc2)nnc1S[C@H](C)C(=O)NN=Cc1cc(Cl)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C22H21Cl2N7O4S/c1-3-8-30-19(12-25-17-6-4-15(23)5-7-17)27-29-22(30)36-13(2)21(33)28-26-11-14-9-16(24)10-18(20(14)32)31(34)35/h3-7,9-11,13,25,32H,1,8,12H2,2H3,(H,28,33)/t13-/m1/s1 |
| InChIKey | CTJDVLYZUMIVSI-CYBMUJFWSA-N |
| XLogP | 4.63 |
| TPSA | 147.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|