C20H19BrClN7O4S — CID 137206896
(2R)-2-[[5-[(4-bromoanilino)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]propanamide (PubChem CID 137206896) has the molecular formula C20H19BrClN7O4S and a molecular weight of 568.84 g/mol. Its IUPAC name is (2R)-2-[[5-[(4-bromoanilino)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]propanamide.
| Compound Name | (2R)-2-[[5-[(4-bromoanilino)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 137206896 |
| Molecular Formula | C20H19BrClN7O4S |
| Molecular Weight | 568.84 g/mol |
| Exact Mass | 567.01 |
| IUPAC Name | (2R)-2-[[5-[(4-bromoanilino)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]propanamide |
| SMILES | C[C@@H](Sc1nnc(CNc2ccc(Br)cc2)n1C)C(=O)NN=Cc1cc(Cl)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C20H19BrClN7O4S/c1-11(19(31)26-24-9-12-7-14(22)8-16(18(12)30)29(32)33)34-20-27-25-17(28(20)2)10-23-15-5-3-13(21)4-6-15/h3-9,11,23,30H,10H2,1-2H3,(H,26,31)/t11-/m1/s1 |
| InChIKey | KPEDPVFAABFPRK-LLVKDONJSA-N |
| XLogP | 4.09 |
| TPSA | 147.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.84 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|