C20H17ClN4O4 — CID 136720633
(2R)-N-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(naphthalen-1-ylamino)propanamide (PubChem CID 136720633) has the molecular formula C20H17ClN4O4 and a molecular weight of 412.83 g/mol. Its IUPAC name is (2R)-N-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(naphthalen-1-ylamino)propanamide.
| Compound Name | (2R)-N-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(naphthalen-1-ylamino)propanamide |
|---|---|
| PubChem CID | 136720633 |
| Molecular Formula | C20H17ClN4O4 |
| Molecular Weight | 412.83 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | (2R)-N-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(naphthalen-1-ylamino)propanamide |
| SMILES | C[C@@H](Nc1cccc2ccccc12)C(=O)N/N=C\c1cc(Cl)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C20H17ClN4O4/c1-12(23-17-8-4-6-13-5-2-3-7-16(13)17)20(27)24-22-11-14-9-15(21)10-18(19(14)26)25(28)29/h2-12,23,26H,1H3,(H,24,27)/b22-11-/t12-/m1/s1 |
| InChIKey | NFQGRZJMWUQIEH-HTGCFNNUSA-N |
| XLogP | 4.06 |
| TPSA | 116.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.83 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|