C22H20N4O — CID 136720604
(2S)-N-[(Z)-1H-indol-3-ylmethylideneamino]-2-(naphthalen-1-ylamino)propanamide (PubChem CID 136720604) has the molecular formula C22H20N4O and a molecular weight of 356.43 g/mol. Its IUPAC name is (2S)-N-[(Z)-1H-indol-3-ylmethylideneamino]-2-(naphthalen-1-ylamino)propanamide.
| Compound Name | (2S)-N-[(Z)-1H-indol-3-ylmethylideneamino]-2-(naphthalen-1-ylamino)propanamide |
|---|---|
| PubChem CID | 136720604 |
| Molecular Formula | C22H20N4O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (2S)-N-[(Z)-1H-indol-3-ylmethylideneamino]-2-(naphthalen-1-ylamino)propanamide |
| SMILES | C[C@H](Nc1cccc2ccccc12)C(=O)N/N=C\c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H20N4O/c1-15(25-21-12-6-8-16-7-2-3-9-18(16)21)22(27)26-24-14-17-13-23-20-11-5-4-10-19(17)20/h2-15,23,25H,1H3,(H,26,27)/b24-14-/t15-/m0/s1 |
| InChIKey | SXEDIASHUUPMFI-YNNOXIHVSA-N |
| XLogP | 4.27 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|