C10H10N4O2 — CID 137212579
1-hydroxy-3-(1H-indol-3-ylmethylideneamino)urea (PubChem CID 137212579) has the molecular formula C10H10N4O2 and a molecular weight of 218.22 g/mol. Its IUPAC name is 1-hydroxy-3-(1H-indol-3-ylmethylideneamino)urea.
| Compound Name | 1-hydroxy-3-(1H-indol-3-ylmethylideneamino)urea |
|---|---|
| PubChem CID | 137212579 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 1-hydroxy-3-(1H-indol-3-ylmethylideneamino)urea |
| SMILES | O=C(NO)NN=Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C10H10N4O2/c15-10(14-16)13-12-6-7-5-11-9-4-2-1-3-8(7)9/h1-6,11,16H,(H2,13,14,15) |
| InChIKey | XHQMYUJDVJNEJU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|