C24H18N6O3 — CID 135782076
5-N-[(E)-1H-indol-3-ylmethylideneamino]-2-N-[(Z)-1H-indol-3-ylmethylideneamino]furan-2,5-dicarboxamide (PubChem CID 135782076) has the molecular formula C24H18N6O3 and a molecular weight of 438.45 g/mol. Its IUPAC name is 5-N-[(E)-1H-indol-3-ylmethylideneamino]-2-N-[(Z)-1H-indol-3-ylmethylideneamino]furan-2,5-dicarboxamide.
| Compound Name | 5-N-[(E)-1H-indol-3-ylmethylideneamino]-2-N-[(Z)-1H-indol-3-ylmethylideneamino]furan-2,5-dicarboxamide |
|---|---|
| PubChem CID | 135782076 |
| Molecular Formula | C24H18N6O3 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 5-N-[(E)-1H-indol-3-ylmethylideneamino]-2-N-[(Z)-1H-indol-3-ylmethylideneamino]furan-2,5-dicarboxamide |
| SMILES | O=C(N/N=C\c1c[nH]c2ccccc12)c1ccc(C(=O)N/N=C/c2c[nH]c3ccccc23)o1 |
| InChI | InChI=1S/C24H18N6O3/c31-23(29-27-13-15-11-25-19-7-3-1-5-17(15)19)21-9-10-22(33-21)24(32)30-28-14-16-12-26-20-8-4-2-6-18(16)20/h1-14,25-26H,(H,29,31)(H,30,32)/b27-13-,28-14+ |
| InChIKey | GVUZNXLFKGWOQW-DYCUMYEBSA-N |
| XLogP | 3.77 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|