C16H15N3O2 — CID 135497938
N-[(E)-1H-indol-3-ylmethylideneamino]-2,5-dimethylfuran-3-carboxamide (PubChem CID 135497938) has the molecular formula C16H15N3O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is N-[(E)-1H-indol-3-ylmethylideneamino]-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-[(E)-1H-indol-3-ylmethylideneamino]-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 135497938 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-[(E)-1H-indol-3-ylmethylideneamino]-2,5-dimethylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)N/N=C/c2c[nH]c3ccccc23)c(C)o1 |
| InChI | InChI=1S/C16H15N3O2/c1-10-7-14(11(2)21-10)16(20)19-18-9-12-8-17-15-6-4-3-5-13(12)15/h3-9,17H,1-2H3,(H,19,20)/b18-9+ |
| InChIKey | CUHGQRBBHUAEDU-GIJQJNRQSA-N |
| XLogP | 3.14 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|