C27H23N7O2 — CID 135606906
3-N,5-N-bis[(E)-1H-indol-3-ylmethylideneamino]-2,6-dimethylpyridine-3,5-dicarboxamide (PubChem CID 135606906) has the molecular formula C27H23N7O2 and a molecular weight of 477.53 g/mol. Its IUPAC name is 3-N,5-N-bis[(E)-1H-indol-3-ylmethylideneamino]-2,6-dimethylpyridine-3,5-dicarboxamide.
| Compound Name | 3-N,5-N-bis[(E)-1H-indol-3-ylmethylideneamino]-2,6-dimethylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 135606906 |
| Molecular Formula | C27H23N7O2 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 3-N,5-N-bis[(E)-1H-indol-3-ylmethylideneamino]-2,6-dimethylpyridine-3,5-dicarboxamide |
| SMILES | Cc1nc(C)c(C(=O)N/N=C/c2c[nH]c3ccccc23)cc1C(=O)N/N=C/c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C27H23N7O2/c1-16-22(26(35)33-30-14-18-12-28-24-9-5-3-7-20(18)24)11-23(17(2)32-16)27(36)34-31-15-19-13-29-25-10-6-4-8-21(19)25/h3-15,28-29H,1-2H3,(H,33,35)(H,34,36)/b30-14+,31-15+ |
| InChIKey | MGIINBBXZARPDH-WCZMLVOGSA-N |
| XLogP | 4.19 |
| TPSA | 127.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|