C19H17N5OS — CID 135811914
(2S)-2-(1,3-benzothiazol-2-ylamino)-N-[(E)-1H-indol-3-ylmethylideneamino]propanamide (PubChem CID 135811914) has the molecular formula C19H17N5OS and a molecular weight of 363.45 g/mol. Its IUPAC name is (2S)-2-(1,3-benzothiazol-2-ylamino)-N-[(E)-1H-indol-3-ylmethylideneamino]propanamide.
| Compound Name | (2S)-2-(1,3-benzothiazol-2-ylamino)-N-[(E)-1H-indol-3-ylmethylideneamino]propanamide |
|---|---|
| PubChem CID | 135811914 |
| Molecular Formula | C19H17N5OS |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | (2S)-2-(1,3-benzothiazol-2-ylamino)-N-[(E)-1H-indol-3-ylmethylideneamino]propanamide |
| SMILES | C[C@H](Nc1nc2ccccc2s1)C(=O)N/N=C/c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H17N5OS/c1-12(22-19-23-16-8-4-5-9-17(16)26-19)18(25)24-21-11-13-10-20-15-7-3-2-6-14(13)15/h2-12,20H,1H3,(H,22,23)(H,24,25)/b21-11+/t12-/m0/s1 |
| InChIKey | ACBHDVSNWMVQDM-OVMKCGGTSA-N |
| XLogP | 3.73 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|