C19H20N4O2S — CID 9398347
(2R)-2-(1,3-benzothiazol-2-ylamino)-N-[(Z)-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]propanamide (PubChem CID 9398347) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is (2R)-2-(1,3-benzothiazol-2-ylamino)-N-[(Z)-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]propanamide.
| Compound Name | (2R)-2-(1,3-benzothiazol-2-ylamino)-N-[(Z)-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]propanamide |
|---|---|
| PubChem CID | 9398347 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (2R)-2-(1,3-benzothiazol-2-ylamino)-N-[(Z)-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]propanamide |
| SMILES | C[C@@H]1C[C@@H]1c1ccc(/C=N\NC(=O)[C@@H](C)Nc2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C19H20N4O2S/c1-11-9-14(11)16-8-7-13(25-16)10-20-23-18(24)12(2)21-19-22-15-5-3-4-6-17(15)26-19/h3-8,10-12,14H,9H2,1-2H3,(H,21,22)(H,23,24)/b20-10-/t11-,12-,14+/m1/s1 |
| InChIKey | XAHPOKAVOOIKKU-MJQWYVIRSA-N |
| XLogP | 3.96 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|