C14H20N2O3 — CID 9391101
tert-butyl N-[(Z)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]carbamate (PubChem CID 9391101) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is tert-butyl N-[(Z)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]carbamate.
| Compound Name | tert-butyl N-[(Z)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 9391101 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | tert-butyl N-[(Z)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]carbamate |
| SMILES | C[C@@H]1C[C@H]1c1ccc(/C=N\NC(=O)OC(C)(C)C)o1 |
| InChI | InChI=1S/C14H20N2O3/c1-9-7-11(9)12-6-5-10(18-12)8-15-16-13(17)19-14(2,3)4/h5-6,8-9,11H,7H2,1-4H3,(H,16,17)/b15-8-/t9-,11-/m1/s1 |
| InChIKey | DNNHCODYVQFREJ-JTAQHWGRSA-N |
| XLogP | 3.26 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|