C14H18N2O4S — CID 9398296
(3S)-N-[(Z)-[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-1,1-dioxothiolane-3-carboxamide (PubChem CID 9398296) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is (3S)-N-[(Z)-[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-1,1-dioxothiolane-3-carboxamide.
| Compound Name | (3S)-N-[(Z)-[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 9398296 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | (3S)-N-[(Z)-[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-1,1-dioxothiolane-3-carboxamide |
| SMILES | C[C@H]1C[C@H]1c1ccc(/C=N\NC(=O)[C@@H]2CCS(=O)(=O)C2)o1 |
| InChI | InChI=1S/C14H18N2O4S/c1-9-6-12(9)13-3-2-11(20-13)7-15-16-14(17)10-4-5-21(18,19)8-10/h2-3,7,9-10,12H,4-6,8H2,1H3,(H,16,17)/b15-7-/t9-,10+,12+/m0/s1 |
| InChIKey | AEFNUNBYDHSHCI-LWXWPFLKSA-N |
| XLogP | 1.29 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|