C10H12N2O2 — CID 871912
N-[(5-methylfuran-2-yl)methylideneamino]cyclopropanecarboxamide (PubChem CID 871912) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is N-[(5-methylfuran-2-yl)methylideneamino]cyclopropanecarboxamide.
| Compound Name | N-[(5-methylfuran-2-yl)methylideneamino]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 871912 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | N-[(5-methylfuran-2-yl)methylideneamino]cyclopropanecarboxamide |
| SMILES | Cc1ccc(C=NNC(=O)C2CC2)o1 |
| InChI | InChI=1S/C10H12N2O2/c1-7-2-5-9(14-7)6-11-12-10(13)8-3-4-8/h2,5-6,8H,3-4H2,1H3,(H,12,13) |
| InChIKey | RLJYTGVENKFOCI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|