C15H12Cl2N2O2 — CID 9234874
N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]cyclopropanecarboxamide (PubChem CID 9234874) has the molecular formula C15H12Cl2N2O2 and a molecular weight of 323.18 g/mol. Its IUPAC name is N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]cyclopropanecarboxamide.
| Compound Name | N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 9234874 |
| Molecular Formula | C15H12Cl2N2O2 |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]cyclopropanecarboxamide |
| SMILES | O=C(N/N=C\c1ccc(-c2cc(Cl)ccc2Cl)o1)C1CC1 |
| InChI | InChI=1S/C15H12Cl2N2O2/c16-10-3-5-13(17)12(7-10)14-6-4-11(21-14)8-18-19-15(20)9-1-2-9/h3-9H,1-2H2,(H,19,20)/b18-8- |
| InChIKey | AHTUMRJXIDCNPS-LSCVHKIXSA-N |
| XLogP | 4.11 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|