C19H12Cl2N2O4 — CID 6218347
N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-1,3-benzodioxole-5-carboxamide (PubChem CID 6218347) has the molecular formula C19H12Cl2N2O4 and a molecular weight of 403.22 g/mol. Its IUPAC name is N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 6218347 |
| Molecular Formula | C19H12Cl2N2O4 |
| Molecular Weight | 403.22 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(-c2cc(Cl)ccc2Cl)o1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H12Cl2N2O4/c20-12-2-4-15(21)14(8-12)16-6-3-13(27-16)9-22-23-19(24)11-1-5-17-18(7-11)26-10-25-17/h1-9H,10H2,(H,23,24)/b22-9- |
| InChIKey | TVLXKDIQCWGXGQ-AFPJDJCSSA-N |
| XLogP | 4.75 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.22 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|