C28H19Cl2N3O5 — CID 4983826
N-[1-(1,3-benzodioxol-5-yl)-3-[2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 4983826) has the molecular formula C28H19Cl2N3O5 and a molecular weight of 548.38 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)-3-[2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)-3-[2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 4983826 |
| Molecular Formula | C28H19Cl2N3O5 |
| Molecular Weight | 548.38 g/mol |
| Exact Mass | 547.07 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)-3-[2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(NN=Cc1ccc(-c2cc(Cl)ccc2Cl)o1)C(=Cc1ccc2c(c1)OCO2)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H19Cl2N3O5/c29-19-7-9-22(30)21(14-19)24-11-8-20(38-24)15-31-33-28(35)23(32-27(34)18-4-2-1-3-5-18)12-17-6-10-25-26(13-17)37-16-36-25/h1-15H,16H2,(H,32,34)(H,33,35) |
| InChIKey | GSFBVMZLRDVWDK-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.38 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|