C25H18BrN3O6 — CID 3886737
N-[1-(1,3-benzodioxol-5-yl)-3-[2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 3886737) has the molecular formula C25H18BrN3O6 and a molecular weight of 536.34 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)-3-[2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)-3-[2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 3886737 |
| Molecular Formula | C25H18BrN3O6 |
| Molecular Weight | 536.34 g/mol |
| Exact Mass | 535.04 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)-3-[2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(NN=Cc1cc2c(cc1Br)OCO2)C(=Cc1ccc2c(c1)OCO2)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H18BrN3O6/c26-18-11-23-22(34-14-35-23)10-17(18)12-27-29-25(31)19(28-24(30)16-4-2-1-3-5-16)8-15-6-7-20-21(9-15)33-13-32-20/h1-12H,13-14H2,(H,28,30)(H,29,31) |
| InChIKey | KYUFZFMYDZZAKV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|