C26H21N3O7 — CID 5347088
2-[2-[(E)-[[(E)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 5347088) has the molecular formula C26H21N3O7 and a molecular weight of 487.47 g/mol. Its IUPAC name is 2-[2-[(E)-[[(E)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[(E)-[[(E)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 5347088 |
| Molecular Formula | C26H21N3O7 |
| Molecular Weight | 487.47 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 2-[2-[(E)-[[(E)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccccc1/C=N/NC(=O)/C(=C\c1ccc2c(c1)OCO2)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H21N3O7/c30-24(31)15-34-21-9-5-4-8-19(21)14-27-29-26(33)20(28-25(32)18-6-2-1-3-7-18)12-17-10-11-22-23(13-17)36-16-35-22/h1-14H,15-16H2,(H,28,32)(H,29,33)(H,30,31)/b20-12+,27-14+ |
| InChIKey | IEKLYFOFECVSGJ-MNXJUHOTSA-N |
| XLogP | 2.80 |
| TPSA | 135.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|