C33H28N4O6 — CID 3861099
[2-[[[2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 3861099) has the molecular formula C33H28N4O6 and a molecular weight of 576.61 g/mol. Its IUPAC name is [2-[[[2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-[[[2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 3861099 |
| Molecular Formula | C33H28N4O6 |
| Molecular Weight | 576.61 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | [2-[[[2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | CN(C)c1ccc(C=C(NC(=O)c2ccccc2)C(=O)NN=Cc2ccccc2OC(=O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C33H28N4O6/c1-37(2)26-15-12-22(13-16-26)18-27(35-31(38)23-8-4-3-5-9-23)32(39)36-34-20-25-10-6-7-11-28(25)43-33(40)24-14-17-29-30(19-24)42-21-41-29/h3-20H,21H2,1-2H3,(H,35,38)(H,36,39) |
| InChIKey | AYYUNNHWOMMEAU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.61 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|