C33H25N3O9 — CID 6295805
[4-[(Z)-[[(E)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 6295805) has the molecular formula C33H25N3O9 and a molecular weight of 607.58 g/mol. Its IUPAC name is [4-[(Z)-[[(E)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [4-[(Z)-[[(E)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 6295805 |
| Molecular Formula | C33H25N3O9 |
| Molecular Weight | 607.58 g/mol |
| Exact Mass | 607.16 |
| IUPAC Name | [4-[(Z)-[[(E)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | COc1cc(/C=N\NC(=O)/C(=C\c2ccc3c(c2)OCO3)NC(=O)c2ccccc2)ccc1OC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C33H25N3O9/c1-40-28-15-21(8-11-27(28)45-33(39)23-9-12-26-30(16-23)44-19-42-26)17-34-36-32(38)24(35-31(37)22-5-3-2-4-6-22)13-20-7-10-25-29(14-20)43-18-41-25/h2-17H,18-19H2,1H3,(H,35,37)(H,36,38)/b24-13+,34-17- |
| InChIKey | LKHKBNJNCBHEKZ-LDVKGFHXSA-N |
| XLogP | 4.29 |
| TPSA | 143.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|