C32H24N4O9 — CID 6322333
[4-[(Z)-[[(Z)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-nitrobenzoate (PubChem CID 6322333) has the molecular formula C32H24N4O9 and a molecular weight of 608.56 g/mol. Its IUPAC name is [4-[(Z)-[[(Z)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-nitrobenzoate.
| Compound Name | [4-[(Z)-[[(Z)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 6322333 |
| Molecular Formula | C32H24N4O9 |
| Molecular Weight | 608.56 g/mol |
| Exact Mass | 608.15 |
| IUPAC Name | [4-[(Z)-[[(Z)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-nitrobenzoate |
| SMILES | COc1cc(/C=N\NC(=O)/C(=C/c2ccc3c(c2)OCO3)NC(=O)c2ccccc2)ccc1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H24N4O9/c1-42-28-17-21(8-14-27(28)45-32(39)23-9-11-24(12-10-23)36(40)41)18-33-35-31(38)25(34-30(37)22-5-3-2-4-6-22)15-20-7-13-26-29(16-20)44-19-43-26/h2-18H,19H2,1H3,(H,34,37)(H,35,38)/b25-15-,33-18- |
| InChIKey | NKUPTWNCXDJYOX-PGBDGEIXSA-N |
| XLogP | 4.47 |
| TPSA | 167.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.56 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|