C24H17N4O7- — CID 7029447
2-[[[(E)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-4-nitrophenolate (PubChem CID 7029447) has the molecular formula C24H17N4O7- and a molecular weight of 473.42 g/mol. Its IUPAC name is 2-[[[(E)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-4-nitrophenolate.
| Compound Name | 2-[[[(E)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 7029447 |
| Molecular Formula | C24H17N4O7- |
| Molecular Weight | 473.42 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 2-[[[(E)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-4-nitrophenolate |
| SMILES | O=C(NN=Cc1cc([N+](=O)[O-])ccc1[O-])/C(=C\c1ccc2c(c1)OCO2)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H18N4O7/c29-20-8-7-18(28(32)33)12-17(20)13-25-27-24(31)19(26-23(30)16-4-2-1-3-5-16)10-15-6-9-21-22(11-15)35-14-34-21/h1-13,29H,14H2,(H,26,30)(H,27,31)/p-1/b19-10+,25-13? |
| InChIKey | UNHDJFMXVJCIBS-ZSKIXMJJSA-M |
| XLogP | 2.32 |
| TPSA | 155.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|