C26H20N4O6 — CID 3988666
N-[1-(1,3-benzodioxol-5-yl)-3-[2-[3-(4-nitrophenyl)prop-2-enylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 3988666) has the molecular formula C26H20N4O6 and a molecular weight of 484.47 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)-3-[2-[3-(4-nitrophenyl)prop-2-enylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)-3-[2-[3-(4-nitrophenyl)prop-2-enylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 3988666 |
| Molecular Formula | C26H20N4O6 |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)-3-[2-[3-(4-nitrophenyl)prop-2-enylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(NN=CC=Cc1ccc([N+](=O)[O-])cc1)C(=Cc1ccc2c(c1)OCO2)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H20N4O6/c31-25(20-6-2-1-3-7-20)28-22(15-19-10-13-23-24(16-19)36-17-35-23)26(32)29-27-14-4-5-18-8-11-21(12-9-18)30(33)34/h1-16H,17H2,(H,28,31)(H,29,32) |
| InChIKey | PAQMUEGKLJUSJK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|