C31H22N4O8 — CID 6322264
[3-[(E)-[[(Z)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate (PubChem CID 6322264) has the molecular formula C31H22N4O8 and a molecular weight of 578.54 g/mol. Its IUPAC name is [3-[(E)-[[(Z)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate.
| Compound Name | [3-[(E)-[[(Z)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 6322264 |
| Molecular Formula | C31H22N4O8 |
| Molecular Weight | 578.54 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | [3-[(E)-[[(Z)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
| SMILES | O=C(N/N=C/c1cccc(OC(=O)c2ccc([N+](=O)[O-])cc2)c1)/C(=C/c1ccc2c(c1)OCO2)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H22N4O8/c36-29(22-6-2-1-3-7-22)33-26(16-20-9-14-27-28(17-20)42-19-41-27)30(37)34-32-18-21-5-4-8-25(15-21)43-31(38)23-10-12-24(13-11-23)35(39)40/h1-18H,19H2,(H,33,36)(H,34,37)/b26-16-,32-18+ |
| InChIKey | FLEFZSZYEPNQEA-GXTVTXEOSA-N |
| XLogP | 4.46 |
| TPSA | 158.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|