C31H25N3O5 — CID 51713584
N-[(E)-1-(1,3-benzodioxol-5-yl)-3-oxo-3-[(2Z)-2-[(3-phenylmethoxyphenyl)methylidene]hydrazinyl]prop-1-en-2-yl]benzamide (PubChem CID 51713584) has the molecular formula C31H25N3O5 and a molecular weight of 519.56 g/mol. Its IUPAC name is N-[(E)-1-(1,3-benzodioxol-5-yl)-3-oxo-3-[(2Z)-2-[(3-phenylmethoxyphenyl)methylidene]hydrazinyl]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(1,3-benzodioxol-5-yl)-3-oxo-3-[(2Z)-2-[(3-phenylmethoxyphenyl)methylidene]hydrazinyl]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 51713584 |
| Molecular Formula | C31H25N3O5 |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | N-[(E)-1-(1,3-benzodioxol-5-yl)-3-oxo-3-[(2Z)-2-[(3-phenylmethoxyphenyl)methylidene]hydrazinyl]prop-1-en-2-yl]benzamide |
| SMILES | O=C(N/N=C\c1cccc(OCc2ccccc2)c1)/C(=C\c1ccc2c(c1)OCO2)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H25N3O5/c35-30(25-11-5-2-6-12-25)33-27(17-23-14-15-28-29(18-23)39-21-38-28)31(36)34-32-19-24-10-7-13-26(16-24)37-20-22-8-3-1-4-9-22/h1-19H,20-21H2,(H,33,35)(H,34,36)/b27-17+,32-19- |
| InChIKey | MYEGOTFKRJVTHS-NRJGIUGHSA-N |
| XLogP | 4.92 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|