C31H22BrN3O6 — CID 98155756
[4-[(Z)-[[(Z)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate (PubChem CID 98155756) has the molecular formula C31H22BrN3O6 and a molecular weight of 612.44 g/mol. Its IUPAC name is [4-[(Z)-[[(Z)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate.
| Compound Name | [4-[(Z)-[[(Z)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 98155756 |
| Molecular Formula | C31H22BrN3O6 |
| Molecular Weight | 612.44 g/mol |
| Exact Mass | 611.07 |
| IUPAC Name | [4-[(Z)-[[(Z)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
| SMILES | O=C(N/N=C\c1ccc(OC(=O)c2ccc(Br)cc2)cc1)/C(=C/c1ccc2c(c1)OCO2)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H22BrN3O6/c32-24-11-9-23(10-12-24)31(38)41-25-13-6-20(7-14-25)18-33-35-30(37)26(34-29(36)22-4-2-1-3-5-22)16-21-8-15-27-28(17-21)40-19-39-27/h1-18H,19H2,(H,34,36)(H,35,37)/b26-16-,33-18- |
| InChIKey | YUGMQNJEGDKFDC-OJLJJKPISA-N |
| XLogP | 5.32 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|