C33H26FN3O7 — CID 5204405
[4-[[[2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-fluorobenzoate (PubChem CID 5204405) has the molecular formula C33H26FN3O7 and a molecular weight of 595.58 g/mol. Its IUPAC name is [4-[[[2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-fluorobenzoate.
| Compound Name | [4-[[[2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 5204405 |
| Molecular Formula | C33H26FN3O7 |
| Molecular Weight | 595.58 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | [4-[[[2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-fluorobenzoate |
| SMILES | CCOc1cc(C=NNC(=O)C(=Cc2ccc3c(c2)OCO3)NC(=O)c2ccccc2)ccc1OC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C33H26FN3O7/c1-2-41-30-18-22(9-15-28(30)44-33(40)24-10-12-25(34)13-11-24)19-35-37-32(39)26(36-31(38)23-6-4-3-5-7-23)16-21-8-14-27-29(17-21)43-20-42-27/h3-19H,2,20H2,1H3,(H,36,38)(H,37,39) |
| InChIKey | KWBYLSOMHHWQKP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|