C24H19BrN2O6 — CID 39451112
[4-[(E)-(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]-2-ethoxyphenyl] 4-bromobenzoate (PubChem CID 39451112) has the molecular formula C24H19BrN2O6 and a molecular weight of 511.33 g/mol. Its IUPAC name is [4-[(E)-(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]-2-ethoxyphenyl] 4-bromobenzoate.
| Compound Name | [4-[(E)-(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]-2-ethoxyphenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 39451112 |
| Molecular Formula | C24H19BrN2O6 |
| Molecular Weight | 511.33 g/mol |
| Exact Mass | 510.04 |
| IUPAC Name | [4-[(E)-(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]-2-ethoxyphenyl] 4-bromobenzoate |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc3c(c2)OCO3)ccc1OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H19BrN2O6/c1-2-30-21-11-15(3-9-20(21)33-24(29)16-4-7-18(25)8-5-16)13-26-27-23(28)17-6-10-19-22(12-17)32-14-31-19/h3-13H,2,14H2,1H3,(H,27,28)/b26-13+ |
| InChIKey | GTHAQIKMYGBBGF-LGJNPRDNSA-N |
| XLogP | 4.56 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|