C21H23BrN2O5 — CID 3730694
[2-ethoxy-4-[[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]phenyl] 4-bromobenzoate (PubChem CID 3730694) has the molecular formula C21H23BrN2O5 and a molecular weight of 463.33 g/mol. Its IUPAC name is [2-ethoxy-4-[[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]phenyl] 4-bromobenzoate.
| Compound Name | [2-ethoxy-4-[[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 3730694 |
| Molecular Formula | C21H23BrN2O5 |
| Molecular Weight | 463.33 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | [2-ethoxy-4-[[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]phenyl] 4-bromobenzoate |
| SMILES | CCOc1cc(C=NNC(=O)OC(C)(C)C)ccc1OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H23BrN2O5/c1-5-27-18-12-14(13-23-24-20(26)29-21(2,3)4)6-11-17(18)28-19(25)15-7-9-16(22)10-8-15/h6-13H,5H2,1-4H3,(H,24,26) |
| InChIKey | RLMRQHWBIVDXPU-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.33 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|