C32H37BrN2O5 — CID 5146803
[2-ethoxy-4-[[[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate (PubChem CID 5146803) has the molecular formula C32H37BrN2O5 and a molecular weight of 609.56 g/mol. Its IUPAC name is [2-ethoxy-4-[[[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate.
| Compound Name | [2-ethoxy-4-[[[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 5146803 |
| Molecular Formula | C32H37BrN2O5 |
| Molecular Weight | 609.56 g/mol |
| Exact Mass | 608.19 |
| IUPAC Name | [2-ethoxy-4-[[[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
| SMILES | CCOc1cc(C=NNC(=O)COc2ccc(C(C)(C)CC(C)(C)C)cc2)ccc1OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C32H37BrN2O5/c1-7-38-28-18-22(8-17-27(28)40-30(37)23-9-13-25(33)14-10-23)19-34-35-29(36)20-39-26-15-11-24(12-16-26)32(5,6)21-31(2,3)4/h8-19H,7,20-21H2,1-6H3,(H,35,36) |
| InChIKey | UMFJCFIFVQRQFP-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.56 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|