C28H30N2O6 — CID 4179543
[2-ethoxy-4-[[[2-(4-ethylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate (PubChem CID 4179543) has the molecular formula C28H30N2O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is [2-ethoxy-4-[[[2-(4-ethylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate.
| Compound Name | [2-ethoxy-4-[[[2-(4-ethylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 4179543 |
| Molecular Formula | C28H30N2O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | [2-ethoxy-4-[[[2-(4-ethylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc(C=NNC(=O)COc3ccc(CC)cc3)cc2OCC)cc1 |
| InChI | InChI=1S/C28H30N2O6/c1-4-20-7-12-24(13-8-20)35-19-27(31)30-29-18-21-9-16-25(26(17-21)34-6-3)36-28(32)22-10-14-23(15-11-22)33-5-2/h7-18H,4-6,19H2,1-3H3,(H,30,31) |
| InChIKey | QJTZEGNAWJFTQO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|