C25H23N3O8 — CID 3598745
[2-methoxy-4-[[[2-(4-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate (PubChem CID 3598745) has the molecular formula C25H23N3O8 and a molecular weight of 493.47 g/mol. Its IUPAC name is [2-methoxy-4-[[[2-(4-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate.
| Compound Name | [2-methoxy-4-[[[2-(4-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 3598745 |
| Molecular Formula | C25H23N3O8 |
| Molecular Weight | 493.47 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | [2-methoxy-4-[[[2-(4-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc(C=NNC(=O)COc3ccc([N+](=O)[O-])cc3)cc2OC)cc1 |
| InChI | InChI=1S/C25H23N3O8/c1-3-34-20-9-5-18(6-10-20)25(30)36-22-13-4-17(14-23(22)33-2)15-26-27-24(29)16-35-21-11-7-19(8-12-21)28(31)32/h4-15H,3,16H2,1-2H3,(H,27,29) |
| InChIKey | SMBPIVGRSSMLJU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|