C24H20ClN3O7 — CID 4196022
[2-ethoxy-4-[[[2-(4-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate (PubChem CID 4196022) has the molecular formula C24H20ClN3O7 and a molecular weight of 497.89 g/mol. Its IUPAC name is [2-ethoxy-4-[[[2-(4-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate.
| Compound Name | [2-ethoxy-4-[[[2-(4-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 4196022 |
| Molecular Formula | C24H20ClN3O7 |
| Molecular Weight | 497.89 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | [2-ethoxy-4-[[[2-(4-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
| SMILES | CCOc1cc(C=NNC(=O)COc2ccc([N+](=O)[O-])cc2)ccc1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C24H20ClN3O7/c1-2-33-22-13-16(7-12-21(22)35-24(30)19-5-3-4-6-20(19)25)14-26-27-23(29)15-34-18-10-8-17(9-11-18)28(31)32/h3-14H,2,15H2,1H3,(H,27,29) |
| InChIKey | WLHURPUPXAYFGA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.89 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|