C32H27N3O8 — CID 126225001
[4-[[[3-(1,3-benzodioxole-5-carbonylamino)benzoyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-methoxybenzoate (PubChem CID 126225001) has the molecular formula C32H27N3O8 and a molecular weight of 581.58 g/mol. Its IUPAC name is [4-[[[3-(1,3-benzodioxole-5-carbonylamino)benzoyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-methoxybenzoate.
| Compound Name | [4-[[[3-(1,3-benzodioxole-5-carbonylamino)benzoyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 126225001 |
| Molecular Formula | C32H27N3O8 |
| Molecular Weight | 581.58 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | [4-[[[3-(1,3-benzodioxole-5-carbonylamino)benzoyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-methoxybenzoate |
| SMILES | CCOc1cc(C=NNC(=O)c2cccc(NC(=O)c3ccc4c(c3)OCO4)c2)ccc1OC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C32H27N3O8/c1-3-40-28-15-20(7-13-27(28)43-32(38)21-8-11-25(39-2)12-9-21)18-33-35-31(37)22-5-4-6-24(16-22)34-30(36)23-10-14-26-29(17-23)42-19-41-26/h4-18H,3,19H2,1-2H3,(H,34,36)(H,35,37) |
| InChIKey | KZNDPSVRWKTNHP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 133.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|