C32H25N3O9 — CID 126233032
[2-[[[3-[(4-acetyloxy-3-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 126233032) has the molecular formula C32H25N3O9 and a molecular weight of 595.56 g/mol. Its IUPAC name is [2-[[[3-[(4-acetyloxy-3-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-[[[3-[(4-acetyloxy-3-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 126233032 |
| Molecular Formula | C32H25N3O9 |
| Molecular Weight | 595.56 g/mol |
| Exact Mass | 595.16 |
| IUPAC Name | [2-[[[3-[(4-acetyloxy-3-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | COc1cc(C(=O)Nc2cccc(C(=O)NN=Cc3ccccc3OC(=O)c3ccc4c(c3)OCO4)c2)ccc1OC(C)=O |
| InChI | InChI=1S/C32H25N3O9/c1-19(36)43-27-13-10-21(15-28(27)40-2)30(37)34-24-8-5-7-20(14-24)31(38)35-33-17-23-6-3-4-9-25(23)44-32(39)22-11-12-26-29(16-22)42-18-41-26/h3-17H,18H2,1-2H3,(H,34,37)(H,35,38) |
| InChIKey | VXVRKAVDELMBPV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 150.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|