C29H20BrN3O6 — CID 126224302
[2-[[(3-benzamidobenzoyl)hydrazinylidene]methyl]-4-bromophenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 126224302) has the molecular formula C29H20BrN3O6 and a molecular weight of 586.40 g/mol. Its IUPAC name is [2-[[(3-benzamidobenzoyl)hydrazinylidene]methyl]-4-bromophenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-[[(3-benzamidobenzoyl)hydrazinylidene]methyl]-4-bromophenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 126224302 |
| Molecular Formula | C29H20BrN3O6 |
| Molecular Weight | 586.40 g/mol |
| Exact Mass | 585.05 |
| IUPAC Name | [2-[[(3-benzamidobenzoyl)hydrazinylidene]methyl]-4-bromophenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | O=C(NN=Cc1cc(Br)ccc1OC(=O)c1ccc2c(c1)OCO2)c1cccc(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C29H20BrN3O6/c30-22-10-12-24(39-29(36)20-9-11-25-26(15-20)38-17-37-25)21(13-22)16-31-33-28(35)19-7-4-8-23(14-19)32-27(34)18-5-2-1-3-6-18/h1-16H,17H2,(H,32,34)(H,33,35) |
| InChIKey | CRXANRJRKUFRKR-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.40 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|