C29H18BrCl2N3O6 — CID 126231516
[4-bromo-2-[[[3-[(2,4-dichlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 126231516) has the molecular formula C29H18BrCl2N3O6 and a molecular weight of 655.29 g/mol. Its IUPAC name is [4-bromo-2-[[[3-[(2,4-dichlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [4-bromo-2-[[[3-[(2,4-dichlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 126231516 |
| Molecular Formula | C29H18BrCl2N3O6 |
| Molecular Weight | 655.29 g/mol |
| Exact Mass | 652.98 |
| IUPAC Name | [4-bromo-2-[[[3-[(2,4-dichlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | O=C(NN=Cc1cc(Br)ccc1OC(=O)c1ccc2c(c1)OCO2)c1cccc(NC(=O)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C29H18BrCl2N3O6/c30-19-5-9-24(41-29(38)17-4-8-25-26(12-17)40-15-39-25)18(10-19)14-33-35-27(36)16-2-1-3-21(11-16)34-28(37)22-7-6-20(31)13-23(22)32/h1-14H,15H2,(H,34,37)(H,35,36) |
| InChIKey | OFVHYQITSXKBFC-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.29 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|