C29H21Cl2N3O4 — CID 126233219
[2-[[[3-[(3-methylbenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 126233219) has the molecular formula C29H21Cl2N3O4 and a molecular weight of 546.41 g/mol. Its IUPAC name is [2-[[[3-[(3-methylbenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [2-[[[3-[(3-methylbenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 126233219 |
| Molecular Formula | C29H21Cl2N3O4 |
| Molecular Weight | 546.41 g/mol |
| Exact Mass | 545.09 |
| IUPAC Name | [2-[[[3-[(3-methylbenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | Cc1cccc(C(=O)Nc2cccc(C(=O)NN=Cc3ccccc3OC(=O)c3ccc(Cl)cc3Cl)c2)c1 |
| InChI | InChI=1S/C29H21Cl2N3O4/c1-18-6-4-8-19(14-18)27(35)33-23-10-5-9-20(15-23)28(36)34-32-17-21-7-2-3-11-26(21)38-29(37)24-13-12-22(30)16-25(24)31/h2-17H,1H3,(H,33,35)(H,34,36) |
| InChIKey | WZUBPTHWPCXUKZ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.41 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|