C21H15Cl2NO2 — CID 4152133
[2-[(3-methylphenyl)iminomethyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 4152133) has the molecular formula C21H15Cl2NO2 and a molecular weight of 384.26 g/mol. Its IUPAC name is [2-[(3-methylphenyl)iminomethyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [2-[(3-methylphenyl)iminomethyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 4152133 |
| Molecular Formula | C21H15Cl2NO2 |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | [2-[(3-methylphenyl)iminomethyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | Cc1cccc(/N=C/c2ccccc2OC(=O)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C21H15Cl2NO2/c1-14-5-4-7-17(11-14)24-13-15-6-2-3-8-20(15)26-21(25)18-10-9-16(22)12-19(18)23/h2-13H,1H3/b24-13+ |
| InChIKey | HOXVBDNBQGLBDF-ZMOGYAJESA-N |
| XLogP | 6.27 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|