C27H14Cl4INO4 — CID 3952520
[3-(2,4-dichlorobenzoyl)oxy-4-[(4-iodophenyl)iminomethyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 3952520) has the molecular formula C27H14Cl4INO4 and a molecular weight of 685.13 g/mol. Its IUPAC name is [3-(2,4-dichlorobenzoyl)oxy-4-[(4-iodophenyl)iminomethyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [3-(2,4-dichlorobenzoyl)oxy-4-[(4-iodophenyl)iminomethyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 3952520 |
| Molecular Formula | C27H14Cl4INO4 |
| Molecular Weight | 685.13 g/mol |
| Exact Mass | 682.87 |
| IUPAC Name | [3-(2,4-dichlorobenzoyl)oxy-4-[(4-iodophenyl)iminomethyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | O=C(Oc1ccc(/C=N/c2ccc(I)cc2)c(OC(=O)c2ccc(Cl)cc2Cl)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H14Cl4INO4/c28-16-2-9-21(23(30)11-16)26(34)36-20-8-1-15(14-33-19-6-4-18(32)5-7-19)25(13-20)37-27(35)22-10-3-17(29)12-24(22)31/h1-14H/b33-14+ |
| InChIKey | RYVWSGKTCNKKMX-ZHSUKTGHSA-N |
| XLogP | 9.09 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.13 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|