C32H39NO5 — CID 136786487
[4-[(4-butylphenyl)iminomethyl]-3-hydroxyphenyl] 2,4-dibutoxybenzoate (PubChem CID 136786487) has the molecular formula C32H39NO5 and a molecular weight of 517.67 g/mol. Its IUPAC name is [4-[(4-butylphenyl)iminomethyl]-3-hydroxyphenyl] 2,4-dibutoxybenzoate.
| Compound Name | [4-[(4-butylphenyl)iminomethyl]-3-hydroxyphenyl] 2,4-dibutoxybenzoate |
|---|---|
| PubChem CID | 136786487 |
| Molecular Formula | C32H39NO5 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.28 |
| IUPAC Name | [4-[(4-butylphenyl)iminomethyl]-3-hydroxyphenyl] 2,4-dibutoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc(/C=N/c3ccc(CCCC)cc3)c(O)c2)c(OCCCC)c1 |
| InChI | InChI=1S/C32H39NO5/c1-4-7-10-24-11-14-26(15-12-24)33-23-25-13-16-28(21-30(25)34)38-32(35)29-18-17-27(36-19-8-5-2)22-31(29)37-20-9-6-3/h11-18,21-23,34H,4-10,19-20H2,1-3H3/b33-23+ |
| InChIKey | HPZKPTXUICVXJD-GZZLJNBRSA-N |
| XLogP | 8.06 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|