C19H23NO2 — CID 137158267
5-propoxy-2-[(4-propylphenyl)iminomethyl]phenol (PubChem CID 137158267) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 5-propoxy-2-[(4-propylphenyl)iminomethyl]phenol.
| Compound Name | 5-propoxy-2-[(4-propylphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 137158267 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 5-propoxy-2-[(4-propylphenyl)iminomethyl]phenol |
| SMILES | CCCOc1ccc(/C=N/c2ccc(CCC)cc2)c(O)c1 |
| InChI | InChI=1S/C19H23NO2/c1-3-5-15-6-9-17(10-7-15)20-14-16-8-11-18(13-19(16)21)22-12-4-2/h6-11,13-14,21H,3-5,12H2,1-2H3/b20-14+ |
| InChIKey | RYXRKMHBHKDVGY-XSFVSMFZSA-N |
| XLogP | 4.88 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|